C14H9N3O — CID 5344961
10-amino-14,15-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2,4,6,9,11,13(16)-heptaen-8-one (PubChem CID 5344961) has the molecular formula C14H9N3O and a molecular weight of 235.25 g/mol. Its IUPAC name is 10-amino-14,15-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2,4,6,9,11,13(16)-heptaen-8-one.
| Compound Name | 10-amino-14,15-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2,4,6,9,11,13(16)-heptaen-8-one |
|---|---|
| PubChem CID | 5344961 |
| Molecular Formula | C14H9N3O |
| Molecular Weight | 235.25 g/mol |
| Exact Mass | 235.07 |
| IUPAC Name | 10-amino-14,15-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2,4,6,9,11,13(16)-heptaen-8-one |
| SMILES | Nc1ccc2[nH]nc3c2c1C(=O)c1ccccc1-3 |
| InChI | InChI=1S/C14H9N3O/c15-9-5-6-10-12-11(9)14(18)8-4-2-1-3-7(8)13(12)17-16-10/h1-6H,15H2,(H,16,17) |
| InChIKey | HTWDCJWXQKOQPP-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.25 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|