About N-[(E)-[2,5-dimethyl-1-(2-methylphenyl)pyrrol-3-yl]methylideneamino]pyridine-4-carboxamide
N-[(E)-[2,5-dimethyl-1-(2-methylphenyl)pyrrol-3-yl]methylideneamino]pyridine-4-carboxamide (PubChem CID 5345302) has the molecular formula C20H20N4O
and a molecular weight of 332.41 g/mol. Its IUPAC name is N-[(E)-[2,5-dimethyl-1-(2-methylphenyl)pyrrol-3-yl]methylideneamino]pyridine-4-carboxamide.
Molecular Properties
| Compound Name | N-[(E)-[2,5-dimethyl-1-(2-methylphenyl)pyrrol-3-yl]methylideneamino]pyridine-4-carboxamide |
| PubChem CID | 5345302 |
| Molecular Formula | C20H20N4O |
| Molecular Weight | 332.41 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | N-[(E)-[2,5-dimethyl-1-(2-methylphenyl)pyrrol-3-yl]methylideneamino]pyridine-4-carboxamide |
| SMILES | Cc1ccccc1-n1c(C)cc(/C=N/NC(=O)c2ccncc2)c1C |
| InChI | InChI=1S/C20H20N4O/c1-14-6-4-5-7-19(14)24-15(2)12-18(16(24)3)13-22-23-20(25)17-8-10-21-11-9-17/h4-13H,1-3H3,(H,23,25)/b22-13+ |
| InChIKey | NBVPFIPTQDJGQS-LPYMAVHISA-N |
| XLogP | 3.56 |
| TPSA | 59.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.41 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[(E)-[2,5-dimethyl-1-(2-methylphenyl)pyrrol-3-yl]methylideneamino]pyridine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(E)-[2,5-dimethyl-1-(2-methylphenyl)pyrrol-3-yl]methylideneamino]pyridine-4-carboxamide?
The IUPAC name of N-[(E)-[2,5-dimethyl-1-(2-methylphenyl)pyrrol-3-yl]methylideneamino]pyridine-4-carboxamide (CID 5345302) is N-[(E)-[2,5-dimethyl-1-(2-methylphenyl)pyrrol-3-yl]methylideneamino]pyridine-4-carboxamide.
What is the SMILES notation for N-[(E)-[2,5-dimethyl-1-(2-methylphenyl)pyrrol-3-yl]methylideneamino]pyridine-4-carboxamide?
The canonical SMILES for N-[(E)-[2,5-dimethyl-1-(2-methylphenyl)pyrrol-3-yl]methylideneamino]pyridine-4-carboxamide is Cc1ccccc1-n1c(C)cc(/C=N/NC(=O)c2ccncc2)c1C.
What is the InChIKey of N-[(E)-[2,5-dimethyl-1-(2-methylphenyl)pyrrol-3-yl]methylideneamino]pyridine-4-carboxamide?
The InChIKey is NBVPFIPTQDJGQS-LPYMAVHISA-N. The full InChI is InChI=1S/C20H20N4O/c1-14-6-4-5-7-19(14)24-15(2)12-18(16(24)3)13-22-23-20(25)17-8-10-21-11-9-17/h4-13H,1-3H3,(H,23,25)/b22-13+.
What are the key properties of N-[(E)-[2,5-dimethyl-1-(2-methylphenyl)pyrrol-3-yl]methylideneamino]pyridine-4-carboxamide?
N-[(E)-[2,5-dimethyl-1-(2-methylphenyl)pyrrol-3-yl]methylideneamino]pyridine-4-carboxamide has a molecular weight of 332.41 g/mol, XLogP of 3.56, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(E)-[2,5-dimethyl-1-(2-methylphenyl)pyrrol-3-yl]methylideneamino]pyridine-4-carboxamide is sourced from PubChem (CID 5345302), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).