C13H18ClN3S — CID 5345741
[amino-[(Z)-(3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)methyl]sulfanylmethylidene]azanium chloride (PubChem CID 5345741) has the molecular formula C13H18ClN3S and a molecular weight of 283.83 g/mol. Its IUPAC name is [amino-[(Z)-(3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)methyl]sulfanylmethylidene]azanium chloride.
| Compound Name | [amino-[(Z)-(3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)methyl]sulfanylmethylidene]azanium chloride |
|---|---|
| PubChem CID | 5345741 |
| Molecular Formula | C13H18ClN3S |
| Molecular Weight | 283.83 g/mol |
| Exact Mass | 283.09 |
| IUPAC Name | [amino-[(Z)-(3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)methyl]sulfanylmethylidene]azanium chloride |
| SMILES | CC1(C)Cc2ccccc2/C(=C/SC(N)=[NH2+])N1.[Cl-] |
| InChI | InChI=1S/C13H17N3S.ClH/c1-13(2)7-9-5-3-4-6-10(9)11(16-13)8-17-12(14)15;/h3-6,8,16H,7H2,1-2H3,(H3,14,15);1H/b11-8-; |
| InChIKey | UTOGTQYZVOFXFX-MKFZHGHUSA-N |
| XLogP | -2.28 |
| TPSA | 63.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.83 |
| LogP ≤ 5 | -2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|