C23H20ClN3O4S — CID 5345901
(4Z)-2-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-5-methyl-4-[(3,4,5-trimethoxyphenyl)methylidene]pyrazol-3-one (PubChem CID 5345901) has the molecular formula C23H20ClN3O4S and a molecular weight of 469.95 g/mol. Its IUPAC name is (4Z)-2-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-5-methyl-4-[(3,4,5-trimethoxyphenyl)methylidene]pyrazol-3-one.
| Compound Name | (4Z)-2-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-5-methyl-4-[(3,4,5-trimethoxyphenyl)methylidene]pyrazol-3-one |
|---|---|
| PubChem CID | 5345901 |
| Molecular Formula | C23H20ClN3O4S |
| Molecular Weight | 469.95 g/mol |
| Exact Mass | 469.09 |
| IUPAC Name | (4Z)-2-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-5-methyl-4-[(3,4,5-trimethoxyphenyl)methylidene]pyrazol-3-one |
| SMILES | COc1cc(/C=C2\C(=O)N(c3nc(-c4ccc(Cl)cc4)cs3)N=C2C)cc(OC)c1OC |
| InChI | InChI=1S/C23H20ClN3O4S/c1-13-17(9-14-10-19(29-2)21(31-4)20(11-14)30-3)22(28)27(26-13)23-25-18(12-32-23)15-5-7-16(24)8-6-15/h5-12H,1-4H3/b17-9- |
| InChIKey | YZHJLLZOAWUZLP-MFOYZWKCSA-N |
| XLogP | 5.30 |
| TPSA | 73.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.95 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|