About 2-nitrohept-2-en-1-ol
2-nitrohept-2-en-1-ol (PubChem CID 534596) has the molecular formula C7H13NO3
and a molecular weight of 159.18 g/mol. Its IUPAC name is 2-nitrohept-2-en-1-ol.
Molecular Properties
| Compound Name | 2-nitrohept-2-en-1-ol |
| PubChem CID | 534596 |
| Molecular Formula | C7H13NO3 |
| Molecular Weight | 159.18 g/mol |
| Exact Mass | 159.09 |
| IUPAC Name | 2-nitrohept-2-en-1-ol |
| SMILES | CCCCC=C(CO)[N+](=O)[O-] |
| InChI | InChI=1S/C7H13NO3/c1-2-3-4-5-7(6-9)8(10)11/h5,9H,2-4,6H2,1H3 |
| InChIKey | ZSRUFXLVZUINSH-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.18 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-nitrohept-2-en-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-nitrohept-2-en-1-ol?
The IUPAC name of 2-nitrohept-2-en-1-ol (CID 534596) is 2-nitrohept-2-en-1-ol.
What is the SMILES notation for 2-nitrohept-2-en-1-ol?
The canonical SMILES for 2-nitrohept-2-en-1-ol is CCCCC=C(CO)[N+](=O)[O-].
What is the InChIKey of 2-nitrohept-2-en-1-ol?
The InChIKey is ZSRUFXLVZUINSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO3/c1-2-3-4-5-7(6-9)8(10)11/h5,9H,2-4,6H2,1H3.
What are the key properties of 2-nitrohept-2-en-1-ol?
2-nitrohept-2-en-1-ol has a molecular weight of 159.18 g/mol, XLogP of 1.33, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-nitrohept-2-en-1-ol is sourced from PubChem (CID 534596), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).