About [(Z)-[amino-(3,4-dimethoxyphenyl)methylidene]amino] 2-methyl-3-nitrobenzoate
[(Z)-[amino-(3,4-dimethoxyphenyl)methylidene]amino] 2-methyl-3-nitrobenzoate (PubChem CID 5345994) has the molecular formula C17H17N3O6
and a molecular weight of 359.34 g/mol. Its IUPAC name is [(Z)-[amino-(3,4-dimethoxyphenyl)methylidene]amino] 2-methyl-3-nitrobenzoate.
Molecular Properties
| Compound Name | [(Z)-[amino-(3,4-dimethoxyphenyl)methylidene]amino] 2-methyl-3-nitrobenzoate |
| PubChem CID | 5345994 |
| Molecular Formula | C17H17N3O6 |
| Molecular Weight | 359.34 g/mol |
| Exact Mass | 359.11 |
| IUPAC Name | [(Z)-[amino-(3,4-dimethoxyphenyl)methylidene]amino] 2-methyl-3-nitrobenzoate |
| SMILES | COc1ccc(/C(N)=N/OC(=O)c2cccc([N+](=O)[O-])c2C)cc1OC |
| InChI | InChI=1S/C17H17N3O6/c1-10-12(5-4-6-13(10)20(22)23)17(21)26-19-16(18)11-7-8-14(24-2)15(9-11)25-3/h4-9H,1-3H3,(H2,18,19) |
| InChIKey | LCMBCJIZNGIBIO-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 126.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.34 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(Z)-[amino-(3,4-dimethoxyphenyl)methylidene]amino] 2-methyl-3-nitrobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z)-[amino-(3,4-dimethoxyphenyl)methylidene]amino] 2-methyl-3-nitrobenzoate?
The IUPAC name of [(Z)-[amino-(3,4-dimethoxyphenyl)methylidene]amino] 2-methyl-3-nitrobenzoate (CID 5345994) is [(Z)-[amino-(3,4-dimethoxyphenyl)methylidene]amino] 2-methyl-3-nitrobenzoate.
What is the SMILES notation for [(Z)-[amino-(3,4-dimethoxyphenyl)methylidene]amino] 2-methyl-3-nitrobenzoate?
The canonical SMILES for [(Z)-[amino-(3,4-dimethoxyphenyl)methylidene]amino] 2-methyl-3-nitrobenzoate is COc1ccc(/C(N)=N/OC(=O)c2cccc([N+](=O)[O-])c2C)cc1OC.
What is the InChIKey of [(Z)-[amino-(3,4-dimethoxyphenyl)methylidene]amino] 2-methyl-3-nitrobenzoate?
The InChIKey is LCMBCJIZNGIBIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17N3O6/c1-10-12(5-4-6-13(10)20(22)23)17(21)26-19-16(18)11-7-8-14(24-2)15(9-11)25-3/h4-9H,1-3H3,(H2,18,19).
What are the key properties of [(Z)-[amino-(3,4-dimethoxyphenyl)methylidene]amino] 2-methyl-3-nitrobenzoate?
[(Z)-[amino-(3,4-dimethoxyphenyl)methylidene]amino] 2-methyl-3-nitrobenzoate has a molecular weight of 359.34 g/mol, XLogP of 2.40, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z)-[amino-(3,4-dimethoxyphenyl)methylidene]amino] 2-methyl-3-nitrobenzoate is sourced from PubChem (CID 5345994), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).