C32H48Cl8N8 — CID 53461431
5,7,15,17,23,25,33,35-octachloro-2,11,20,29,37,38,39,40-octazanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontane (PubChem CID 53461431) has the molecular formula C32H48Cl8N8 and a molecular weight of 828.42 g/mol. Its IUPAC name is 5,7,15,17,23,25,33,35-octachloro-2,11,20,29,37,38,39,40-octazanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontane.
| Compound Name | 5,7,15,17,23,25,33,35-octachloro-2,11,20,29,37,38,39,40-octazanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontane |
|---|---|
| PubChem CID | 53461431 |
| Molecular Formula | C32H48Cl8N8 |
| Molecular Weight | 828.42 g/mol |
| Exact Mass | 824.15 |
| IUPAC Name | 5,7,15,17,23,25,33,35-octachloro-2,11,20,29,37,38,39,40-octazanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontane |
| SMILES | ClC1CC(Cl)C2C3NC(NC4NC(NC5NC(NC6NC(N3)C3C(Cl)CC(Cl)CC63)C3CC(Cl)CC(Cl)C53)C3C(Cl)CC(Cl)CC43)C2C1 |
| InChI | InChI=1S/C32H48Cl8N8/c33-9-1-13-21(17(37)5-9)29-43-25(13)41-26-14-2-10(34)6-18(38)22(14)31(44-26)48-32-24-16(4-12(36)8-20(24)40)28(46-32)42-27-15-3-11(35)7-19(39)23(15)30(45-27)47-29/h9-32,41-48H,1-8H2 |
| InChIKey | ODSPNOVNAJLIEY-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 96.24 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 828.42 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|