C23H35N3O2 — CID 53462989
13-(hexoxymethyl)-9-methyl-10-propan-2-yl-3,9,12-triazatricyclo[6.6.1.04,15]pentadeca-1,4(15),5,7-tetraen-11-one (PubChem CID 53462989) has the molecular formula C23H35N3O2 and a molecular weight of 385.55 g/mol. Its IUPAC name is 13-(hexoxymethyl)-9-methyl-10-propan-2-yl-3,9,12-triazatricyclo[6.6.1.04,15]pentadeca-1,4(15),5,7-tetraen-11-one.
| Compound Name | 13-(hexoxymethyl)-9-methyl-10-propan-2-yl-3,9,12-triazatricyclo[6.6.1.04,15]pentadeca-1,4(15),5,7-tetraen-11-one |
|---|---|
| PubChem CID | 53462989 |
| Molecular Formula | C23H35N3O2 |
| Molecular Weight | 385.55 g/mol |
| Exact Mass | 385.27 |
| IUPAC Name | 13-(hexoxymethyl)-9-methyl-10-propan-2-yl-3,9,12-triazatricyclo[6.6.1.04,15]pentadeca-1,4(15),5,7-tetraen-11-one |
| SMILES | CCCCCCOCC1Cc2c[nH]c3cccc(c23)N(C)C(C(C)C)C(=O)N1 |
| InChI | InChI=1S/C23H35N3O2/c1-5-6-7-8-12-28-15-18-13-17-14-24-19-10-9-11-20(21(17)19)26(4)22(16(2)3)23(27)25-18/h9-11,14,16,18,22,24H,5-8,12-13,15H2,1-4H3,(H,25,27) |
| InChIKey | YVQPFXSKFFVKNQ-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.55 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|