C20H28O3 — CID 53463366
5-ethenyl-14-hydroxy-1,5,12-trimethyl-10-oxatetracyclo[7.6.1.02,7.012,16]hexadec-7-en-11-one (PubChem CID 53463366) has the molecular formula C20H28O3 and a molecular weight of 316.44 g/mol. Its IUPAC name is 5-ethenyl-14-hydroxy-1,5,12-trimethyl-10-oxatetracyclo[7.6.1.02,7.012,16]hexadec-7-en-11-one.
| Compound Name | 5-ethenyl-14-hydroxy-1,5,12-trimethyl-10-oxatetracyclo[7.6.1.02,7.012,16]hexadec-7-en-11-one |
|---|---|
| PubChem CID | 53463366 |
| Molecular Formula | C20H28O3 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.20 |
| IUPAC Name | 5-ethenyl-14-hydroxy-1,5,12-trimethyl-10-oxatetracyclo[7.6.1.02,7.012,16]hexadec-7-en-11-one |
| SMILES | C=CC1(C)CCC2C(=CC3OC(=O)C4(C)CC(O)CC2(C)C34)C1 |
| InChI | InChI=1S/C20H28O3/c1-5-18(2)7-6-14-12(9-18)8-15-16-19(14,3)10-13(21)11-20(16,4)17(22)23-15/h5,8,13-16,21H,1,6-7,9-11H2,2-4H3 |
| InChIKey | VSXVHWPQGHHXGS-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|