C24H20F2N4O3 — CID 53464882
(4S)-1'-fluoro-7'-(2-fluoro-3-pyridinyl)-3'-(oxan-4-yl)spiro[5H-1,3-oxazole-4,5'-chromeno[2,3-c]pyridine]-2-amine (PubChem CID 53464882) has the molecular formula C24H20F2N4O3 and a molecular weight of 450.40 g/mol. Its IUPAC name is (4S)-1'-fluoro-7'-(2-fluoro-3-pyridinyl)-3'-(oxan-4-yl)spiro[5H-1,3-oxazole-4,5'-chromeno[2,3-c]pyridine]-2-amine.
| Compound Name | (4S)-1'-fluoro-7'-(2-fluoro-3-pyridinyl)-3'-(oxan-4-yl)spiro[5H-1,3-oxazole-4,5'-chromeno[2,3-c]pyridine]-2-amine |
|---|---|
| PubChem CID | 53464882 |
| Molecular Formula | C24H20F2N4O3 |
| Molecular Weight | 450.40 g/mol |
| Exact Mass | 450.15 |
| IUPAC Name | (4S)-1'-fluoro-7'-(2-fluoro-3-pyridinyl)-3'-(oxan-4-yl)spiro[5H-1,3-oxazole-4,5'-chromeno[2,3-c]pyridine]-2-amine |
| SMILES | C1COCCC1C2=NC(=C3C(=C2)[C@]4(COC(=N4)N)C5=C(O3)C=CC(=C5)C6=C(N=CC=C6)F)F |
| InChI | InChI=1S/C24H20F2N4O3/c25-21-15(2-1-7-28-21)14-3-4-19-16(10-14)24(12-32-23(27)30-24)17-11-18(13-5-8-31-9-6-13)29-22(26)20(17)33-19/h1-4,7,10-11,13H,5-6,8-9,12H2,(H2,27,30)/t24-/m0/s1 |
| InChIKey | GKNHZGHUSLOLRK-DEOSSOPVSA-N |
| XLogP | 2.80 |
| TPSA | 91.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | 753 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.40 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|