C39H41F6N5O2 — CID 53465000
6-N,6-N-dimethyl-3-[(4-piperidin-1-ylpiperidin-1-yl)methyl]-2-[3-(trifluoromethyl)phenyl]-4-N-[(1R)-2,2,2-trifluoro-1-phenylethyl]quinoline-4,6-dicarboxamide (PubChem CID 53465000) has the molecular formula C39H41F6N5O2 and a molecular weight of 725.78 g/mol. Its IUPAC name is 6-N,6-N-dimethyl-3-[(4-piperidin-1-ylpiperidin-1-yl)methyl]-2-[3-(trifluoromethyl)phenyl]-4-N-[(1R)-2,2,2-trifluoro-1-phenylethyl]quinoline-4,6-dicarboxamide.
| Compound Name | 6-N,6-N-dimethyl-3-[(4-piperidin-1-ylpiperidin-1-yl)methyl]-2-[3-(trifluoromethyl)phenyl]-4-N-[(1R)-2,2,2-trifluoro-1-phenylethyl]quinoline-4,6-dicarboxamide |
|---|---|
| PubChem CID | 53465000 |
| Molecular Formula | C39H41F6N5O2 |
| Molecular Weight | 725.78 g/mol |
| Exact Mass | 725.32 |
| IUPAC Name | 6-N,6-N-dimethyl-3-[(4-piperidin-1-ylpiperidin-1-yl)methyl]-2-[3-(trifluoromethyl)phenyl]-4-N-[(1R)-2,2,2-trifluoro-1-phenylethyl]quinoline-4,6-dicarboxamide |
| SMILES | CN(C)C(=O)c1ccc2nc(-c3cccc(C(F)(F)F)c3)c(CN3CCC(N4CCCCC4)CC3)c(C(=O)N[C@H](c3ccccc3)C(F)(F)F)c2c1 |
| InChI | InChI=1S/C39H41F6N5O2/c1-48(2)37(52)27-14-15-32-30(23-27)33(36(51)47-35(39(43,44)45)25-10-5-3-6-11-25)31(34(46-32)26-12-9-13-28(22-26)38(40,41)42)24-49-20-16-29(17-21-49)50-18-7-4-8-19-50/h3,5-6,9-15,22-23,29,35H,4,7-8,16-21,24H2,1-2H3,(H,47,51)/t35-/m1/s1 |
| InChIKey | ODOSJPZERHJAKJ-PGUFJCEWSA-N |
| XLogP | 8.11 |
| TPSA | 68.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 725.78 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |