C27H31N3O2 — CID 53465165
4-(4-phenylphenoxy)-N-[[(3R)-1-propan-2-ylpiperidin-3-yl]methyl]pyridine-2-carboxamide (PubChem CID 53465165) has the molecular formula C27H31N3O2 and a molecular weight of 429.56 g/mol. Its IUPAC name is 4-(4-phenylphenoxy)-N-[[(3R)-1-propan-2-ylpiperidin-3-yl]methyl]pyridine-2-carboxamide.
| Compound Name | 4-(4-phenylphenoxy)-N-[[(3R)-1-propan-2-ylpiperidin-3-yl]methyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 53465165 |
| Molecular Formula | C27H31N3O2 |
| Molecular Weight | 429.56 g/mol |
| Exact Mass | 429.24 |
| IUPAC Name | 4-(4-phenylphenoxy)-N-[[(3R)-1-propan-2-ylpiperidin-3-yl]methyl]pyridine-2-carboxamide |
| SMILES | CC(C)N1CCC[C@H](CNC(=O)c2cc(Oc3ccc(-c4ccccc4)cc3)ccn2)C1 |
| InChI | InChI=1S/C27H31N3O2/c1-20(2)30-16-6-7-21(19-30)18-29-27(31)26-17-25(14-15-28-26)32-24-12-10-23(11-13-24)22-8-4-3-5-9-22/h3-5,8-15,17,20-21H,6-7,16,18-19H2,1-2H3,(H,29,31)/t21-/m1/s1 |
| InChIKey | AOUFPXBGFYKOJI-OAQYLSRUSA-N |
| XLogP | 5.39 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.56 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |