About [(Z)-[amino(pyridin-2-yl)methylidene]amino] 2,2-diphenylacetate
[(Z)-[amino(pyridin-2-yl)methylidene]amino] 2,2-diphenylacetate (PubChem CID 5346524) has the molecular formula C20H17N3O2
and a molecular weight of 331.38 g/mol. Its IUPAC name is [(Z)-[amino(pyridin-2-yl)methylidene]amino] 2,2-diphenylacetate.
Molecular Properties
| Compound Name | [(Z)-[amino(pyridin-2-yl)methylidene]amino] 2,2-diphenylacetate |
| PubChem CID | 5346524 |
| Molecular Formula | C20H17N3O2 |
| Molecular Weight | 331.38 g/mol |
| Exact Mass | 331.13 |
| IUPAC Name | [(Z)-[amino(pyridin-2-yl)methylidene]amino] 2,2-diphenylacetate |
| SMILES | N/C(=N\OC(=O)C(c1ccccc1)c1ccccc1)c1ccccn1 |
| InChI | InChI=1S/C20H17N3O2/c21-19(17-13-7-8-14-22-17)23-25-20(24)18(15-9-3-1-4-10-15)16-11-5-2-6-12-16/h1-14,18H,(H2,21,23) |
| InChIKey | XEEGJTWVBAMGJY-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 77.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.38 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(Z)-[amino(pyridin-2-yl)methylidene]amino] 2,2-diphenylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z)-[amino(pyridin-2-yl)methylidene]amino] 2,2-diphenylacetate?
The IUPAC name of [(Z)-[amino(pyridin-2-yl)methylidene]amino] 2,2-diphenylacetate (CID 5346524) is [(Z)-[amino(pyridin-2-yl)methylidene]amino] 2,2-diphenylacetate.
What is the SMILES notation for [(Z)-[amino(pyridin-2-yl)methylidene]amino] 2,2-diphenylacetate?
The canonical SMILES for [(Z)-[amino(pyridin-2-yl)methylidene]amino] 2,2-diphenylacetate is N/C(=N\OC(=O)C(c1ccccc1)c1ccccc1)c1ccccn1.
What is the InChIKey of [(Z)-[amino(pyridin-2-yl)methylidene]amino] 2,2-diphenylacetate?
The InChIKey is XEEGJTWVBAMGJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H17N3O2/c21-19(17-13-7-8-14-22-17)23-25-20(24)18(15-9-3-1-4-10-15)16-11-5-2-6-12-16/h1-14,18H,(H2,21,23).
What are the key properties of [(Z)-[amino(pyridin-2-yl)methylidene]amino] 2,2-diphenylacetate?
[(Z)-[amino(pyridin-2-yl)methylidene]amino] 2,2-diphenylacetate has a molecular weight of 331.38 g/mol, XLogP of 3.08, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z)-[amino(pyridin-2-yl)methylidene]amino] 2,2-diphenylacetate is sourced from PubChem (CID 5346524), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).