About 2-hydroxyethyl(trimethyl)azanium;2-[(3,5,6-trichloro-2-pyridinyl)oxy]acetate
2-hydroxyethyl(trimethyl)azanium;2-[(3,5,6-trichloro-2-pyridinyl)oxy]acetate (PubChem CID 53465339) has the molecular formula C12H17Cl3N2O4
and a molecular weight of 359.64 g/mol. Its IUPAC name is 2-hydroxyethyl(trimethyl)azanium;2-[(3,5,6-trichloro-2-pyridinyl)oxy]acetate.
Molecular Properties
| Compound Name | 2-hydroxyethyl(trimethyl)azanium;2-[(3,5,6-trichloro-2-pyridinyl)oxy]acetate |
| PubChem CID | 53465339 |
| Molecular Formula | C12H17Cl3N2O4 |
| Molecular Weight | 359.64 g/mol |
| Exact Mass | 358.03 |
| IUPAC Name | 2-hydroxyethyl(trimethyl)azanium;2-[(3,5,6-trichloro-2-pyridinyl)oxy]acetate |
| SMILES | C[N+](C)(C)CCO.O=C([O-])COc1nc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C7H4Cl3NO3.C5H14NO/c8-3-1-4(9)7(11-6(3)10)14-2-5(12)13;1-6(2,3)4-5-7/h1H,2H2,(H,12,13);7H,4-5H2,1-3H3/q;+1/p-1 |
| InChIKey | CCRUKTGQASMHHB-UHFFFAOYSA-M |
| XLogP | 0.86 |
| TPSA | 82.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.64 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxyethyl(trimethyl)azanium;2-[(3,5,6-trichloro-2-pyridinyl)oxy]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxyethyl(trimethyl)azanium;2-[(3,5,6-trichloro-2-pyridinyl)oxy]acetate?
The IUPAC name of 2-hydroxyethyl(trimethyl)azanium;2-[(3,5,6-trichloro-2-pyridinyl)oxy]acetate (CID 53465339) is 2-hydroxyethyl(trimethyl)azanium;2-[(3,5,6-trichloro-2-pyridinyl)oxy]acetate.
What is the SMILES notation for 2-hydroxyethyl(trimethyl)azanium;2-[(3,5,6-trichloro-2-pyridinyl)oxy]acetate?
The canonical SMILES for 2-hydroxyethyl(trimethyl)azanium;2-[(3,5,6-trichloro-2-pyridinyl)oxy]acetate is C[N+](C)(C)CCO.O=C([O-])COc1nc(Cl)c(Cl)cc1Cl.
What is the InChIKey of 2-hydroxyethyl(trimethyl)azanium;2-[(3,5,6-trichloro-2-pyridinyl)oxy]acetate?
The InChIKey is CCRUKTGQASMHHB-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H4Cl3NO3.C5H14NO/c8-3-1-4(9)7(11-6(3)10)14-2-5(12)13;1-6(2,3)4-5-7/h1H,2H2,(H,12,13);7H,4-5H2,1-3H3/q;+1/p-1.
What are the key properties of 2-hydroxyethyl(trimethyl)azanium;2-[(3,5,6-trichloro-2-pyridinyl)oxy]acetate?
2-hydroxyethyl(trimethyl)azanium;2-[(3,5,6-trichloro-2-pyridinyl)oxy]acetate has a molecular weight of 359.64 g/mol, XLogP of 0.86, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxyethyl(trimethyl)azanium;2-[(3,5,6-trichloro-2-pyridinyl)oxy]acetate is sourced from PubChem (CID 53465339), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).