C18H21F3N4O4 — CID 53465372
(6S)-2-nitro-N-[1-[4-(trifluoromethoxy)phenyl]pentyl]-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazin-6-amine (PubChem CID 53465372) has the molecular formula C18H21F3N4O4 and a molecular weight of 414.38 g/mol. Its IUPAC name is (6S)-2-nitro-N-[1-[4-(trifluoromethoxy)phenyl]pentyl]-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazin-6-amine.
| Compound Name | (6S)-2-nitro-N-[1-[4-(trifluoromethoxy)phenyl]pentyl]-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazin-6-amine |
|---|---|
| PubChem CID | 53465372 |
| Molecular Formula | C18H21F3N4O4 |
| Molecular Weight | 414.38 g/mol |
| Exact Mass | 414.15 |
| IUPAC Name | (6S)-2-nitro-N-[1-[4-(trifluoromethoxy)phenyl]pentyl]-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazin-6-amine |
| SMILES | CCCCC(N[C@@H]1COc2nc([N+](=O)[O-])cn2C1)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C18H21F3N4O4/c1-2-3-4-15(12-5-7-14(8-6-12)29-18(19,20)21)22-13-9-24-10-16(25(26)27)23-17(24)28-11-13/h5-8,10,13,15,22H,2-4,9,11H2,1H3/t13-,15?/m0/s1 |
| InChIKey | POOYYDWBMWNHSE-CFMCSPIPSA-N |
| XLogP | 3.97 |
| TPSA | 91.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.38 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|