C15H15F3N4O5 — CID 53465374
2-[[(6S)-2-nitro-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazin-6-yl]amino]-2-[4-(trifluoromethoxy)phenyl]ethanol (PubChem CID 53465374) has the molecular formula C15H15F3N4O5 and a molecular weight of 388.30 g/mol. Its IUPAC name is 2-[[(6S)-2-nitro-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazin-6-yl]amino]-2-[4-(trifluoromethoxy)phenyl]ethanol.
| Compound Name | 2-[[(6S)-2-nitro-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazin-6-yl]amino]-2-[4-(trifluoromethoxy)phenyl]ethanol |
|---|---|
| PubChem CID | 53465374 |
| Molecular Formula | C15H15F3N4O5 |
| Molecular Weight | 388.30 g/mol |
| Exact Mass | 388.10 |
| IUPAC Name | 2-[[(6S)-2-nitro-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazin-6-yl]amino]-2-[4-(trifluoromethoxy)phenyl]ethanol |
| SMILES | O=[N+]([O-])c1cn2c(n1)OC[C@@H](NC(CO)c1ccc(OC(F)(F)F)cc1)C2 |
| InChI | InChI=1S/C15H15F3N4O5/c16-15(17,18)27-11-3-1-9(2-4-11)12(7-23)19-10-5-21-6-13(22(24)25)20-14(21)26-8-10/h1-4,6,10,12,19,23H,5,7-8H2/t10-,12?/m0/s1 |
| InChIKey | LJDDAMIHUNACNT-NUHJPDEHSA-N |
| XLogP | 1.77 |
| TPSA | 111.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.30 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|