About N-[[4-[2-(3,3-difluoropyrrolidin-1-yl)sulfonylphenyl]phenyl]methyl]-2-methylpropan-1-amine
N-[[4-[2-(3,3-difluoropyrrolidin-1-yl)sulfonylphenyl]phenyl]methyl]-2-methylpropan-1-amine (PubChem CID 53465411) has the molecular formula C21H26F2N2O2S
and a molecular weight of 408.51 g/mol. Its IUPAC name is N-[[4-[2-(3,3-difluoropyrrolidin-1-yl)sulfonylphenyl]phenyl]methyl]-2-methylpropan-1-amine.
Molecular Properties
| Compound Name | N-[[4-[2-(3,3-difluoropyrrolidin-1-yl)sulfonylphenyl]phenyl]methyl]-2-methylpropan-1-amine |
| PubChem CID | 53465411 |
| Molecular Formula | C21H26F2N2O2S |
| Molecular Weight | 408.51 g/mol |
| Exact Mass | 408.17 |
| IUPAC Name | N-[[4-[2-(3,3-difluoropyrrolidin-1-yl)sulfonylphenyl]phenyl]methyl]-2-methylpropan-1-amine |
| SMILES | CC(C)CNCc1ccc(-c2ccccc2S(=O)(=O)N2CCC(F)(F)C2)cc1 |
| InChI | InChI=1S/C21H26F2N2O2S/c1-16(2)13-24-14-17-7-9-18(10-8-17)19-5-3-4-6-20(19)28(26,27)25-12-11-21(22,23)15-25/h3-10,16,24H,11-15H2,1-2H3 |
| InChIKey | QKMSUYZQEWXVSN-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 408.51 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[[4-[2-(3,3-difluoropyrrolidin-1-yl)sulfonylphenyl]phenyl]methyl]-2-methylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[4-[2-(3,3-difluoropyrrolidin-1-yl)sulfonylphenyl]phenyl]methyl]-2-methylpropan-1-amine?
The IUPAC name of N-[[4-[2-(3,3-difluoropyrrolidin-1-yl)sulfonylphenyl]phenyl]methyl]-2-methylpropan-1-amine (CID 53465411) is N-[[4-[2-(3,3-difluoropyrrolidin-1-yl)sulfonylphenyl]phenyl]methyl]-2-methylpropan-1-amine.
What is the SMILES notation for N-[[4-[2-(3,3-difluoropyrrolidin-1-yl)sulfonylphenyl]phenyl]methyl]-2-methylpropan-1-amine?
The canonical SMILES for N-[[4-[2-(3,3-difluoropyrrolidin-1-yl)sulfonylphenyl]phenyl]methyl]-2-methylpropan-1-amine is CC(C)CNCc1ccc(-c2ccccc2S(=O)(=O)N2CCC(F)(F)C2)cc1.
What is the InChIKey of N-[[4-[2-(3,3-difluoropyrrolidin-1-yl)sulfonylphenyl]phenyl]methyl]-2-methylpropan-1-amine?
The InChIKey is QKMSUYZQEWXVSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H26F2N2O2S/c1-16(2)13-24-14-17-7-9-18(10-8-17)19-5-3-4-6-20(19)28(26,27)25-12-11-21(22,23)15-25/h3-10,16,24H,11-15H2,1-2H3.
What are the key properties of N-[[4-[2-(3,3-difluoropyrrolidin-1-yl)sulfonylphenyl]phenyl]methyl]-2-methylpropan-1-amine?
N-[[4-[2-(3,3-difluoropyrrolidin-1-yl)sulfonylphenyl]phenyl]methyl]-2-methylpropan-1-amine has a molecular weight of 408.51 g/mol, XLogP of 4.13, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[4-[2-(3,3-difluoropyrrolidin-1-yl)sulfonylphenyl]phenyl]methyl]-2-methylpropan-1-amine is sourced from PubChem (CID 53465411), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).