C14H24O5 — CID 53465503
(4S,5S)-5-[(E,1R,2R,6R,7S)-1,7-dihydroxy-2,6-dimethyloct-4-enyl]-4-hydroxyoxolan-2-one (PubChem CID 53465503) has the molecular formula C14H24O5 and a molecular weight of 272.34 g/mol. Its IUPAC name is (4S,5S)-5-[(E,1R,2R,6R,7S)-1,7-dihydroxy-2,6-dimethyloct-4-enyl]-4-hydroxyoxolan-2-one.
| Compound Name | (4S,5S)-5-[(E,1R,2R,6R,7S)-1,7-dihydroxy-2,6-dimethyloct-4-enyl]-4-hydroxyoxolan-2-one |
|---|---|
| PubChem CID | 53465503 |
| Molecular Formula | C14H24O5 |
| Molecular Weight | 272.34 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | (4S,5S)-5-[(E,1R,2R,6R,7S)-1,7-dihydroxy-2,6-dimethyloct-4-enyl]-4-hydroxyoxolan-2-one |
| SMILES | C[C@H](O)[C@H](C)/C=C/C[C@@H](C)[C@@H](O)[C@H]1OC(=O)C[C@@H]1O |
| InChI | InChI=1S/C14H24O5/c1-8(10(3)15)5-4-6-9(2)13(18)14-11(16)7-12(17)19-14/h4-5,8-11,13-16,18H,6-7H2,1-3H3/b5-4+/t8-,9-,10+,11+,13-,14+/m1/s1 |
| InChIKey | AKVNYEYIRKXNJP-JZTXUPKOSA-N |
| XLogP | 0.62 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.34 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|