C28H27N3O4 — CID 53465845
ethyl 2-[[2-(1H-indole-2-carbonylamino)benzoyl]amino]-4-phenylbutanoate (PubChem CID 53465845) has the molecular formula C28H27N3O4 and a molecular weight of 469.54 g/mol. Its IUPAC name is ethyl 2-[[2-(1H-indole-2-carbonylamino)benzoyl]amino]-4-phenylbutanoate.
| Compound Name | ethyl 2-[[2-(1H-indole-2-carbonylamino)benzoyl]amino]-4-phenylbutanoate |
|---|---|
| PubChem CID | 53465845 |
| Molecular Formula | C28H27N3O4 |
| Molecular Weight | 469.54 g/mol |
| Exact Mass | 469.20 |
| IUPAC Name | ethyl 2-[[2-(1H-indole-2-carbonylamino)benzoyl]amino]-4-phenylbutanoate |
| SMILES | CCOC(=O)C(CCc1ccccc1)NC(=O)c1ccccc1NC(=O)c1cc2ccccc2[nH]1 |
| InChI | InChI=1S/C28H27N3O4/c1-2-35-28(34)24(17-16-19-10-4-3-5-11-19)31-26(32)21-13-7-9-15-23(21)30-27(33)25-18-20-12-6-8-14-22(20)29-25/h3-15,18,24,29H,2,16-17H2,1H3,(H,30,33)(H,31,32) |
| InChIKey | SFVWSGBMIVQXIR-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 100.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.54 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |