C26H31N3O — CID 53465849
3-[2-amino-6-(2-methylphenyl)quinolin-3-yl]-N-(cyclohexylmethyl)propanamide (PubChem CID 53465849) has the molecular formula C26H31N3O and a molecular weight of 401.55 g/mol. Its IUPAC name is 3-[2-amino-6-(2-methylphenyl)quinolin-3-yl]-N-(cyclohexylmethyl)propanamide.
| Compound Name | 3-[2-amino-6-(2-methylphenyl)quinolin-3-yl]-N-(cyclohexylmethyl)propanamide |
|---|---|
| PubChem CID | 53465849 |
| Molecular Formula | C26H31N3O |
| Molecular Weight | 401.55 g/mol |
| Exact Mass | 401.25 |
| IUPAC Name | 3-[2-amino-6-(2-methylphenyl)quinolin-3-yl]-N-(cyclohexylmethyl)propanamide |
| SMILES | Cc1ccccc1-c1ccc2nc(N)c(CCC(=O)NCC3CCCCC3)cc2c1 |
| InChI | InChI=1S/C26H31N3O/c1-18-7-5-6-10-23(18)20-11-13-24-22(15-20)16-21(26(27)29-24)12-14-25(30)28-17-19-8-3-2-4-9-19/h5-7,10-11,13,15-16,19H,2-4,8-9,12,14,17H2,1H3,(H2,27,29)(H,28,30) |
| InChIKey | WHCBVAPBSFXPHD-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.55 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |