C13H26O3Si — CID 53465923
(3R,3aR,5R,6aR)-5-[tert-butyl(dimethyl)silyl]oxy-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-3-ol (PubChem CID 53465923) has the molecular formula C13H26O3Si and a molecular weight of 258.43 g/mol. Its IUPAC name is (3R,3aR,5R,6aR)-5-[tert-butyl(dimethyl)silyl]oxy-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-3-ol.
| Compound Name | (3R,3aR,5R,6aR)-5-[tert-butyl(dimethyl)silyl]oxy-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-3-ol |
|---|---|
| PubChem CID | 53465923 |
| Molecular Formula | C13H26O3Si |
| Molecular Weight | 258.43 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | (3R,3aR,5R,6aR)-5-[tert-butyl(dimethyl)silyl]oxy-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-3-ol |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1C[C@@H]2[C@@H](O)CO[C@@H]2C1 |
| InChI | InChI=1S/C13H26O3Si/c1-13(2,3)17(4,5)16-9-6-10-11(14)8-15-12(10)7-9/h9-12,14H,6-8H2,1-5H3/t9-,10-,11+,12-/m1/s1 |
| InChIKey | ZKIPCSVQDTVAPR-WISYIIOYSA-N |
| XLogP | 2.55 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.43 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|