C9H14O4 — CID 53465924
[(3R,3aS,5R,6aR)-5-hydroxy-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-3-yl] acetate (PubChem CID 53465924) has the molecular formula C9H14O4 and a molecular weight of 186.21 g/mol. Its IUPAC name is [(3R,3aS,5R,6aR)-5-hydroxy-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-3-yl] acetate.
| Compound Name | [(3R,3aS,5R,6aR)-5-hydroxy-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-3-yl] acetate |
|---|---|
| PubChem CID | 53465924 |
| Molecular Formula | C9H14O4 |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.09 |
| IUPAC Name | [(3R,3aS,5R,6aR)-5-hydroxy-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1CO[C@@H]2C[C@H](O)C[C@H]12 |
| InChI | InChI=1S/C9H14O4/c1-5(10)13-9-4-12-8-3-6(11)2-7(8)9/h6-9,11H,2-4H2,1H3/t6-,7+,8-,9+/m1/s1 |
| InChIKey | VSTZFNQGSGGMNT-XAVMHZPKSA-N |
| XLogP | 0.09 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |