C11H10N6S2 — CID 53466643
6-thiomorpholin-4-yl-8-thia-3,4,5,10,13-pentazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaene (PubChem CID 53466643) has the molecular formula C11H10N6S2 and a molecular weight of 290.38 g/mol. Its IUPAC name is 6-thiomorpholin-4-yl-8-thia-3,4,5,10,13-pentazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaene.
| Compound Name | 6-thiomorpholin-4-yl-8-thia-3,4,5,10,13-pentazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaene |
|---|---|
| PubChem CID | 53466643 |
| Molecular Formula | C11H10N6S2 |
| Molecular Weight | 290.38 g/mol |
| Exact Mass | 290.04 |
| IUPAC Name | 6-thiomorpholin-4-yl-8-thia-3,4,5,10,13-pentazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaene |
| SMILES | c1cnc2c(n1)sc1c(N3CCSCC3)nnnc12 |
| InChI | InChI=1S/C11H10N6S2/c1-2-13-11-8(12-1)7-9(19-11)10(15-16-14-7)17-3-5-18-6-4-17/h1-2H,3-6H2 |
| InChIKey | AICIWZMVNDUSKC-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 67.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.38 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |