C20H27BrIN2O11P — CID 53466649
[[(E)-4-[5-[(E)-1-bromo-2-iodoethenyl]-2,4-dioxopyrimidin-1-yl]but-2-enyl]-(propan-2-yloxycarbonyloxymethoxy)phosphoryl]oxymethyl propan-2-yl carbonate (PubChem CID 53466649) has the molecular formula C20H27BrIN2O11P and a molecular weight of 709.22 g/mol. Its IUPAC name is [[(E)-4-[5-[(E)-1-bromo-2-iodoethenyl]-2,4-dioxopyrimidin-1-yl]but-2-enyl]-(propan-2-yloxycarbonyloxymethoxy)phosphoryl]oxymethyl propan-2-yl carbonate.
| Compound Name | [[(E)-4-[5-[(E)-1-bromo-2-iodoethenyl]-2,4-dioxopyrimidin-1-yl]but-2-enyl]-(propan-2-yloxycarbonyloxymethoxy)phosphoryl]oxymethyl propan-2-yl carbonate |
|---|---|
| PubChem CID | 53466649 |
| Molecular Formula | C20H27BrIN2O11P |
| Molecular Weight | 709.22 g/mol |
| Exact Mass | 707.96 |
| IUPAC Name | [[(E)-4-[5-[(E)-1-bromo-2-iodoethenyl]-2,4-dioxopyrimidin-1-yl]but-2-enyl]-(propan-2-yloxycarbonyloxymethoxy)phosphoryl]oxymethyl propan-2-yl carbonate |
| SMILES | CC(C)OC(=O)OCOP(=O)(C/C=C/Cn1cc(/C(Br)=C\I)c(=O)[nH]c1=O)OCOC(=O)OC(C)C |
| InChI | InChI=1S/C20H27BrIN2O11P/c1-13(2)34-19(27)30-11-32-36(29,33-12-31-20(28)35-14(3)4)8-6-5-7-24-10-15(16(21)9-22)17(25)23-18(24)26/h5-6,9-10,13-14H,7-8,11-12H2,1-4H3,(H,23,25,26)/b6-5+,16-9+ |
| InChIKey | WDUVZBXCWKVLEW-CBYOJRPNSA-N |
| XLogP | 4.49 |
| TPSA | 161.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.22 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|