C26H30F4N2O3 — CID 53466663
(3S,9S)-3-[3-fluoro-5-(trifluoromethyl)-2-pyridinyl]-7,7-dimethyl-4-propan-2-ylspiro[3,6,8,9-tetrahydrofuro[3,4-c]quinoline-1,4'-oxane]-9-ol (PubChem CID 53466663) has the molecular formula C26H30F4N2O3 and a molecular weight of 494.53 g/mol. Its IUPAC name is (3S,9S)-3-[3-fluoro-5-(trifluoromethyl)-2-pyridinyl]-7,7-dimethyl-4-propan-2-ylspiro[3,6,8,9-tetrahydrofuro[3,4-c]quinoline-1,4'-oxane]-9-ol.
| Compound Name | (3S,9S)-3-[3-fluoro-5-(trifluoromethyl)-2-pyridinyl]-7,7-dimethyl-4-propan-2-ylspiro[3,6,8,9-tetrahydrofuro[3,4-c]quinoline-1,4'-oxane]-9-ol |
|---|---|
| PubChem CID | 53466663 |
| Molecular Formula | C26H30F4N2O3 |
| Molecular Weight | 494.53 g/mol |
| Exact Mass | 494.22 |
| IUPAC Name | (3S,9S)-3-[3-fluoro-5-(trifluoromethyl)-2-pyridinyl]-7,7-dimethyl-4-propan-2-ylspiro[3,6,8,9-tetrahydrofuro[3,4-c]quinoline-1,4'-oxane]-9-ol |
| SMILES | CC(C)c1nc2c(c3c1[C@@H](c1ncc(C(F)(F)F)cc1F)OC31CCOCC1)[C@@H](O)CC(C)(C)C2 |
| InChI | InChI=1S/C26H30F4N2O3/c1-13(2)21-19-20(18-16(32-21)10-24(3,4)11-17(18)33)25(5-7-34-8-6-25)35-23(19)22-15(27)9-14(12-31-22)26(28,29)30/h9,12-13,17,23,33H,5-8,10-11H2,1-4H3/t17-,23-/m0/s1 |
| InChIKey | JXEDLPSILVHFLT-SBUREZEXSA-N |
| XLogP | 5.89 |
| TPSA | 64.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.53 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |