C13H14N8O4 — CID 5346668
1-[(E)-[3-methoxy-4-[(4-methyl-2-oxido-1,2,5-oxadiazol-2-ium-3-yl)methoxy]phenyl]methylideneamino]tetrazol-5-amine (PubChem CID 5346668) has the molecular formula C13H14N8O4 and a molecular weight of 346.31 g/mol. Its IUPAC name is 1-[(E)-[3-methoxy-4-[(4-methyl-2-oxido-1,2,5-oxadiazol-2-ium-3-yl)methoxy]phenyl]methylideneamino]tetrazol-5-amine.
| Compound Name | 1-[(E)-[3-methoxy-4-[(4-methyl-2-oxido-1,2,5-oxadiazol-2-ium-3-yl)methoxy]phenyl]methylideneamino]tetrazol-5-amine |
|---|---|
| PubChem CID | 5346668 |
| Molecular Formula | C13H14N8O4 |
| Molecular Weight | 346.31 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | 1-[(E)-[3-methoxy-4-[(4-methyl-2-oxido-1,2,5-oxadiazol-2-ium-3-yl)methoxy]phenyl]methylideneamino]tetrazol-5-amine |
| SMILES | COc1cc(/C=N/n2nnnc2N)ccc1OCc1c(C)no[n+]1[O-] |
| InChI | InChI=1S/C13H14N8O4/c1-8-10(21(22)25-17-8)7-24-11-4-3-9(5-12(11)23-2)6-15-20-13(14)16-18-19-20/h3-6H,7H2,1-2H3,(H2,14,16,19)/b15-6+ |
| InChIKey | JAJHGXPHZRGSGC-GIDUJCDVSA-N |
| XLogP | -0.35 |
| TPSA | 153.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.31 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'} |
|---|