C24H17F3N6O — CID 53466694
5-(3-methoxyphenyl)-2-[7-[(2,3,5-trifluorophenyl)methyl]imidazo[1,5-b]pyridazin-5-yl]pyrimidin-4-amine (PubChem CID 53466694) has the molecular formula C24H17F3N6O and a molecular weight of 462.44 g/mol. Its IUPAC name is 5-(3-methoxyphenyl)-2-[7-[(2,3,5-trifluorophenyl)methyl]imidazo[1,5-b]pyridazin-5-yl]pyrimidin-4-amine.
| Compound Name | 5-(3-methoxyphenyl)-2-[7-[(2,3,5-trifluorophenyl)methyl]imidazo[1,5-b]pyridazin-5-yl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 53466694 |
| Molecular Formula | C24H17F3N6O |
| Molecular Weight | 462.44 g/mol |
| Exact Mass | 462.14 |
| IUPAC Name | 5-(3-methoxyphenyl)-2-[7-[(2,3,5-trifluorophenyl)methyl]imidazo[1,5-b]pyridazin-5-yl]pyrimidin-4-amine |
| SMILES | COc1cccc(-c2cnc(-c3nc(Cc4cc(F)cc(F)c4F)n4ncccc34)nc2N)c1 |
| InChI | InChI=1S/C24H17F3N6O/c1-34-16-5-2-4-13(9-16)17-12-29-24(32-23(17)28)22-19-6-3-7-30-33(19)20(31-22)10-14-8-15(25)11-18(26)21(14)27/h2-9,11-12H,10H2,1H3,(H2,28,29,32) |
| InChIKey | ROLVPBHAFMKUBM-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 91.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.44 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|