About 5-bromo-2,6-di(pyrazol-1-yl)pyrimidin-4-amine
5-bromo-2,6-di(pyrazol-1-yl)pyrimidin-4-amine (PubChem CID 53466958) has the molecular formula C10H8BrN7
and a molecular weight of 306.13 g/mol. Its IUPAC name is 5-bromo-2,6-di(pyrazol-1-yl)pyrimidin-4-amine.
Molecular Properties
| Compound Name | 5-bromo-2,6-di(pyrazol-1-yl)pyrimidin-4-amine |
| PubChem CID | 53466958 |
| Molecular Formula | C10H8BrN7 |
| Molecular Weight | 306.13 g/mol |
| Exact Mass | 305.00 |
| IUPAC Name | 5-bromo-2,6-di(pyrazol-1-yl)pyrimidin-4-amine |
| SMILES | Nc1nc(-n2cccn2)nc(-n2cccn2)c1Br |
| InChI | InChI=1S/C10H8BrN7/c11-7-8(12)15-10(18-6-2-4-14-18)16-9(7)17-5-1-3-13-17/h1-6H,(H2,12,15,16) |
| InChIKey | ATFXVNUWQOXRRU-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 87.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.13 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 5-bromo-2,6-di(pyrazol-1-yl)pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-2,6-di(pyrazol-1-yl)pyrimidin-4-amine?
The IUPAC name of 5-bromo-2,6-di(pyrazol-1-yl)pyrimidin-4-amine (CID 53466958) is 5-bromo-2,6-di(pyrazol-1-yl)pyrimidin-4-amine.
What is the SMILES notation for 5-bromo-2,6-di(pyrazol-1-yl)pyrimidin-4-amine?
The canonical SMILES for 5-bromo-2,6-di(pyrazol-1-yl)pyrimidin-4-amine is Nc1nc(-n2cccn2)nc(-n2cccn2)c1Br.
What is the InChIKey of 5-bromo-2,6-di(pyrazol-1-yl)pyrimidin-4-amine?
The InChIKey is ATFXVNUWQOXRRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8BrN7/c11-7-8(12)15-10(18-6-2-4-14-18)16-9(7)17-5-1-3-13-17/h1-6H,(H2,12,15,16).
What are the key properties of 5-bromo-2,6-di(pyrazol-1-yl)pyrimidin-4-amine?
5-bromo-2,6-di(pyrazol-1-yl)pyrimidin-4-amine has a molecular weight of 306.13 g/mol, XLogP of 1.19, 2 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-2,6-di(pyrazol-1-yl)pyrimidin-4-amine is sourced from PubChem (CID 53466958), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).