C25H50O5Si — CID 53467252
(4S,5R,6R)-4-(hydroxymethyl)-2,2-dimethyl-6-[(E,2R,6R,7S)-6-methyl-7-tri(propan-2-yl)silyloxyoct-4-en-2-yl]-1,3-dioxan-5-ol (PubChem CID 53467252) has the molecular formula C25H50O5Si and a molecular weight of 458.76 g/mol. Its IUPAC name is (4S,5R,6R)-4-(hydroxymethyl)-2,2-dimethyl-6-[(E,2R,6R,7S)-6-methyl-7-tri(propan-2-yl)silyloxyoct-4-en-2-yl]-1,3-dioxan-5-ol.
| Compound Name | (4S,5R,6R)-4-(hydroxymethyl)-2,2-dimethyl-6-[(E,2R,6R,7S)-6-methyl-7-tri(propan-2-yl)silyloxyoct-4-en-2-yl]-1,3-dioxan-5-ol |
|---|---|
| PubChem CID | 53467252 |
| Molecular Formula | C25H50O5Si |
| Molecular Weight | 458.76 g/mol |
| Exact Mass | 458.34 |
| IUPAC Name | (4S,5R,6R)-4-(hydroxymethyl)-2,2-dimethyl-6-[(E,2R,6R,7S)-6-methyl-7-tri(propan-2-yl)silyloxyoct-4-en-2-yl]-1,3-dioxan-5-ol |
| SMILES | CC(C)[Si](O[C@@H](C)[C@H](C)/C=C/C[C@@H](C)[C@H]1OC(C)(C)O[C@@H](CO)[C@@H]1O)(C(C)C)C(C)C |
| InChI | InChI=1S/C25H50O5Si/c1-16(2)31(17(3)4,18(5)6)30-21(9)19(7)13-12-14-20(8)24-23(27)22(15-26)28-25(10,11)29-24/h12-13,16-24,26-27H,14-15H2,1-11H3/b13-12+/t19-,20-,21+,22+,23+,24-/m1/s1 |
| InChIKey | LPHIDJPKAIBEHT-GNISRUMASA-N |
| XLogP | 5.66 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.76 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|