C47H74N2O13 — CID 53467285
(2E,5E)-2,5-bis[[4-[bis[2-[2-(2-methoxyethoxy)ethoxy]ethyl]amino]phenyl]methylidene]cyclopentan-1-one (PubChem CID 53467285) has the molecular formula C47H74N2O13 and a molecular weight of 875.11 g/mol. Its IUPAC name is (2E,5E)-2,5-bis[[4-[bis[2-[2-(2-methoxyethoxy)ethoxy]ethyl]amino]phenyl]methylidene]cyclopentan-1-one.
| Compound Name | (2E,5E)-2,5-bis[[4-[bis[2-[2-(2-methoxyethoxy)ethoxy]ethyl]amino]phenyl]methylidene]cyclopentan-1-one |
|---|---|
| PubChem CID | 53467285 |
| Molecular Formula | C47H74N2O13 |
| Molecular Weight | 875.11 g/mol |
| Exact Mass | 874.52 |
| IUPAC Name | (2E,5E)-2,5-bis[[4-[bis[2-[2-(2-methoxyethoxy)ethoxy]ethyl]amino]phenyl]methylidene]cyclopentan-1-one |
| SMILES | COCCOCCOCCN(CCOCCOCCOC)c1ccc(/C=C2\CC/C(=C\c3ccc(N(CCOCCOCCOC)CCOCCOCCOC)cc3)C2=O)cc1 |
| InChI | InChI=1S/C47H74N2O13/c1-51-23-27-59-35-31-55-19-15-48(16-20-56-32-36-60-28-24-52-2)45-11-5-41(6-12-45)39-43-9-10-44(47(43)50)40-42-7-13-46(14-8-42)49(17-21-57-33-37-61-29-25-53-3)18-22-58-34-38-62-30-26-54-4/h5-8,11-14,39-40H,9-10,15-38H2,1-4H3/b43-39+,44-40+ |
| InChIKey | MDAZCLYCCBBQLI-UUHCYPSGSA-N |
| XLogP | 4.85 |
| TPSA | 134.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 40 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 875.11 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|