C27H32F3NO2 — CID 53467539
(3R,9S)-7,7-dimethyl-4-propan-2-yl-3-[4-(trifluoromethyl)phenyl]spiro[3,6,8,9-tetrahydrofuro[3,4-c]quinoline-1,1'-cyclopentane]-9-ol (PubChem CID 53467539) has the molecular formula C27H32F3NO2 and a molecular weight of 459.55 g/mol. Its IUPAC name is (3R,9S)-7,7-dimethyl-4-propan-2-yl-3-[4-(trifluoromethyl)phenyl]spiro[3,6,8,9-tetrahydrofuro[3,4-c]quinoline-1,1'-cyclopentane]-9-ol.
| Compound Name | (3R,9S)-7,7-dimethyl-4-propan-2-yl-3-[4-(trifluoromethyl)phenyl]spiro[3,6,8,9-tetrahydrofuro[3,4-c]quinoline-1,1'-cyclopentane]-9-ol |
|---|---|
| PubChem CID | 53467539 |
| Molecular Formula | C27H32F3NO2 |
| Molecular Weight | 459.55 g/mol |
| Exact Mass | 459.24 |
| IUPAC Name | (3R,9S)-7,7-dimethyl-4-propan-2-yl-3-[4-(trifluoromethyl)phenyl]spiro[3,6,8,9-tetrahydrofuro[3,4-c]quinoline-1,1'-cyclopentane]-9-ol |
| SMILES | CC(C)c1nc2c(c3c1[C@@H](c1ccc(C(F)(F)F)cc1)OC31CCCC1)[C@@H](O)CC(C)(C)C2 |
| InChI | InChI=1S/C27H32F3NO2/c1-15(2)23-21-22(20-18(31-23)13-25(3,4)14-19(20)32)26(11-5-6-12-26)33-24(21)16-7-9-17(10-8-16)27(28,29)30/h7-10,15,19,24,32H,5-6,11-14H2,1-4H3/t19-,24+/m0/s1 |
| InChIKey | XQVSUCVPHONOCM-YADARESESA-N |
| XLogP | 7.12 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.55 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |