C18H16F2N4O2 — CID 53467578
2-[(3R)-6-fluoro-3-[(5-fluoropyrimidin-2-yl)amino]-1,2,3,4-tetrahydrocarbazol-9-yl]acetic acid (PubChem CID 53467578) has the molecular formula C18H16F2N4O2 and a molecular weight of 358.35 g/mol. Its IUPAC name is 2-[(3R)-6-fluoro-3-[(5-fluoropyrimidin-2-yl)amino]-1,2,3,4-tetrahydrocarbazol-9-yl]acetic acid.
| Compound Name | 2-[(3R)-6-fluoro-3-[(5-fluoropyrimidin-2-yl)amino]-1,2,3,4-tetrahydrocarbazol-9-yl]acetic acid |
|---|---|
| PubChem CID | 53467578 |
| Molecular Formula | C18H16F2N4O2 |
| Molecular Weight | 358.35 g/mol |
| Exact Mass | 358.12 |
| IUPAC Name | 2-[(3R)-6-fluoro-3-[(5-fluoropyrimidin-2-yl)amino]-1,2,3,4-tetrahydrocarbazol-9-yl]acetic acid |
| SMILES | O=C(O)Cn1c2c(c3cc(F)ccc31)C[C@H](Nc1ncc(F)cn1)CC2 |
| InChI | InChI=1S/C18H16F2N4O2/c19-10-1-3-15-13(5-10)14-6-12(23-18-21-7-11(20)8-22-18)2-4-16(14)24(15)9-17(25)26/h1,3,5,7-8,12H,2,4,6,9H2,(H,25,26)(H,21,22,23)/t12-/m1/s1 |
| InChIKey | ABVWNFNHZIHFOG-GFCCVEGCSA-N |
| XLogP | 2.76 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.35 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|