C23H23NO6 — CID 5346761
4-[(3E)-3-[hydroxy-(4-methylphenyl)methylidene]-2-(2-methoxyphenyl)-4,5-dioxopyrrolidin-1-yl]butanoic acid (PubChem CID 5346761) has the molecular formula C23H23NO6 and a molecular weight of 409.44 g/mol. Its IUPAC name is 4-[(3E)-3-[hydroxy-(4-methylphenyl)methylidene]-2-(2-methoxyphenyl)-4,5-dioxopyrrolidin-1-yl]butanoic acid.
| Compound Name | 4-[(3E)-3-[hydroxy-(4-methylphenyl)methylidene]-2-(2-methoxyphenyl)-4,5-dioxopyrrolidin-1-yl]butanoic acid |
|---|---|
| PubChem CID | 5346761 |
| Molecular Formula | C23H23NO6 |
| Molecular Weight | 409.44 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | 4-[(3E)-3-[hydroxy-(4-methylphenyl)methylidene]-2-(2-methoxyphenyl)-4,5-dioxopyrrolidin-1-yl]butanoic acid |
| SMILES | COc1ccccc1C1/C(=C(\O)c2ccc(C)cc2)C(=O)C(=O)N1CCCC(=O)O |
| InChI | InChI=1S/C23H23NO6/c1-14-9-11-15(12-10-14)21(27)19-20(16-6-3-4-7-17(16)30-2)24(23(29)22(19)28)13-5-8-18(25)26/h3-4,6-7,9-12,20,27H,5,8,13H2,1-2H3,(H,25,26)/b21-19+ |
| InChIKey | BHWIPIANRFLYQA-XUTLUUPISA-N |
| XLogP | 3.29 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.44 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|