C29H46F3NO3 — CID 53467742
(1S,4R,5R,6R,11R,12S,16R,18S,21R)-4,6,12,17,17-pentamethyl-8-[(2,2,2-trifluoroethylamino)methyl]-9-oxahexacyclo[11.9.0.01,21.04,12.05,10.016,21]docosane-11,18-diol (PubChem CID 53467742) has the molecular formula C29H46F3NO3 and a molecular weight of 513.69 g/mol. Its IUPAC name is (1S,4R,5R,6R,11R,12S,16R,18S,21R)-4,6,12,17,17-pentamethyl-8-[(2,2,2-trifluoroethylamino)methyl]-9-oxahexacyclo[11.9.0.01,21.04,12.05,10.016,21]docosane-11,18-diol.
| Compound Name | (1S,4R,5R,6R,11R,12S,16R,18S,21R)-4,6,12,17,17-pentamethyl-8-[(2,2,2-trifluoroethylamino)methyl]-9-oxahexacyclo[11.9.0.01,21.04,12.05,10.016,21]docosane-11,18-diol |
|---|---|
| PubChem CID | 53467742 |
| Molecular Formula | C29H46F3NO3 |
| Molecular Weight | 513.69 g/mol |
| Exact Mass | 513.34 |
| IUPAC Name | (1S,4R,5R,6R,11R,12S,16R,18S,21R)-4,6,12,17,17-pentamethyl-8-[(2,2,2-trifluoroethylamino)methyl]-9-oxahexacyclo[11.9.0.01,21.04,12.05,10.016,21]docosane-11,18-diol |
| SMILES | C[C@@H]1CC(CNCC(F)(F)F)OC2[C@H]1[C@@]1(C)CC[C@@]34C[C@@]35CC[C@H](O)C(C)(C)[C@@H]5CCC4[C@]1(C)[C@H]2O |
| InChI | InChI=1S/C29H46F3NO3/c1-16-12-17(13-33-15-29(30,31)32)36-22-21(16)25(4)10-11-28-14-27(28)9-8-20(34)24(2,3)18(27)6-7-19(28)26(25,5)23(22)35/h16-23,33-35H,6-15H2,1-5H3/t16-,17?,18+,19?,20+,21+,22?,23+,25-,26-,27-,28+/m1/s1 |
| InChIKey | UGXQKYAIJLOWCO-XMDRHNBASA-N |
| XLogP | 5.31 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.69 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |