C25H30F3NO2 — CID 53467748
(3R,9S)-1,1,7,7-tetramethyl-4-propan-2-yl-3-[4-(trifluoromethyl)phenyl]-3,6,8,9-tetrahydrofuro[3,4-c]quinolin-9-ol (PubChem CID 53467748) has the molecular formula C25H30F3NO2 and a molecular weight of 433.51 g/mol. Its IUPAC name is (3R,9S)-1,1,7,7-tetramethyl-4-propan-2-yl-3-[4-(trifluoromethyl)phenyl]-3,6,8,9-tetrahydrofuro[3,4-c]quinolin-9-ol.
| Compound Name | (3R,9S)-1,1,7,7-tetramethyl-4-propan-2-yl-3-[4-(trifluoromethyl)phenyl]-3,6,8,9-tetrahydrofuro[3,4-c]quinolin-9-ol |
|---|---|
| PubChem CID | 53467748 |
| Molecular Formula | C25H30F3NO2 |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.22 |
| IUPAC Name | (3R,9S)-1,1,7,7-tetramethyl-4-propan-2-yl-3-[4-(trifluoromethyl)phenyl]-3,6,8,9-tetrahydrofuro[3,4-c]quinolin-9-ol |
| SMILES | CC(C)c1nc2c(c3c1[C@@H](c1ccc(C(F)(F)F)cc1)OC3(C)C)[C@@H](O)CC(C)(C)C2 |
| InChI | InChI=1S/C25H30F3NO2/c1-13(2)21-19-20(18-16(29-21)11-23(3,4)12-17(18)30)24(5,6)31-22(19)14-7-9-15(10-8-14)25(26,27)28/h7-10,13,17,22,30H,11-12H2,1-6H3/t17-,22+/m0/s1 |
| InChIKey | YDSOWCFXOXJMGU-HTAPYJJXSA-N |
| XLogP | 6.58 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |