C28H34F3NO3 — CID 53467750
(3R,9S)-4-tert-butyl-7,7-dimethyl-3-[4-(trifluoromethyl)phenyl]spiro[3,6,8,9-tetrahydrofuro[3,4-c]quinoline-1,4'-oxane]-9-ol (PubChem CID 53467750) has the molecular formula C28H34F3NO3 and a molecular weight of 489.58 g/mol. Its IUPAC name is (3R,9S)-4-tert-butyl-7,7-dimethyl-3-[4-(trifluoromethyl)phenyl]spiro[3,6,8,9-tetrahydrofuro[3,4-c]quinoline-1,4'-oxane]-9-ol.
| Compound Name | (3R,9S)-4-tert-butyl-7,7-dimethyl-3-[4-(trifluoromethyl)phenyl]spiro[3,6,8,9-tetrahydrofuro[3,4-c]quinoline-1,4'-oxane]-9-ol |
|---|---|
| PubChem CID | 53467750 |
| Molecular Formula | C28H34F3NO3 |
| Molecular Weight | 489.58 g/mol |
| Exact Mass | 489.25 |
| IUPAC Name | (3R,9S)-4-tert-butyl-7,7-dimethyl-3-[4-(trifluoromethyl)phenyl]spiro[3,6,8,9-tetrahydrofuro[3,4-c]quinoline-1,4'-oxane]-9-ol |
| SMILES | CC1(C)Cc2nc(C(C)(C)C)c3c(c2[C@@H](O)C1)C1(CCOCC1)O[C@@H]3c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C28H34F3NO3/c1-25(2,3)24-21-22(20-18(32-24)14-26(4,5)15-19(20)33)27(10-12-34-13-11-27)35-23(21)16-6-8-17(9-7-16)28(29,30)31/h6-9,19,23,33H,10-15H2,1-5H3/t19-,23+/m0/s1 |
| InChIKey | NSQYJMLMLUBXER-WMZHIEFXSA-N |
| XLogP | 6.53 |
| TPSA | 51.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.58 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |