C30H41NO2 — CID 53467965
(3R,9S)-3-(4-tert-butylphenyl)-7,7-dimethyl-4-propan-2-ylspiro[3,6,8,9-tetrahydrofuro[3,4-c]quinoline-1,1'-cyclopentane]-9-ol (PubChem CID 53467965) has the molecular formula C30H41NO2 and a molecular weight of 447.66 g/mol. Its IUPAC name is (3R,9S)-3-(4-tert-butylphenyl)-7,7-dimethyl-4-propan-2-ylspiro[3,6,8,9-tetrahydrofuro[3,4-c]quinoline-1,1'-cyclopentane]-9-ol.
| Compound Name | (3R,9S)-3-(4-tert-butylphenyl)-7,7-dimethyl-4-propan-2-ylspiro[3,6,8,9-tetrahydrofuro[3,4-c]quinoline-1,1'-cyclopentane]-9-ol |
|---|---|
| PubChem CID | 53467965 |
| Molecular Formula | C30H41NO2 |
| Molecular Weight | 447.66 g/mol |
| Exact Mass | 447.31 |
| IUPAC Name | (3R,9S)-3-(4-tert-butylphenyl)-7,7-dimethyl-4-propan-2-ylspiro[3,6,8,9-tetrahydrofuro[3,4-c]quinoline-1,1'-cyclopentane]-9-ol |
| SMILES | CC(C)c1nc2c(c3c1[C@@H](c1ccc(C(C)(C)C)cc1)OC31CCCC1)[C@@H](O)CC(C)(C)C2 |
| InChI | InChI=1S/C30H41NO2/c1-18(2)26-24-25(23-21(31-26)16-29(6,7)17-22(23)32)30(14-8-9-15-30)33-27(24)19-10-12-20(13-11-19)28(3,4)5/h10-13,18,22,27,32H,8-9,14-17H2,1-7H3/t22-,27+/m0/s1 |
| InChIKey | MGZRSEQBULXLST-WXVAWEFUSA-N |
| XLogP | 7.40 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.66 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |