C25H18F4N6O2S — CID 53468008
2-[5-fluoro-3-[(2,3,6-trifluorophenyl)methyl]indazol-1-yl]-5-(3-methylsulfonylphenyl)pyrimidine-4,6-diamine (PubChem CID 53468008) has the molecular formula C25H18F4N6O2S and a molecular weight of 542.52 g/mol. Its IUPAC name is 2-[5-fluoro-3-[(2,3,6-trifluorophenyl)methyl]indazol-1-yl]-5-(3-methylsulfonylphenyl)pyrimidine-4,6-diamine.
| Compound Name | 2-[5-fluoro-3-[(2,3,6-trifluorophenyl)methyl]indazol-1-yl]-5-(3-methylsulfonylphenyl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 53468008 |
| Molecular Formula | C25H18F4N6O2S |
| Molecular Weight | 542.52 g/mol |
| Exact Mass | 542.11 |
| IUPAC Name | 2-[5-fluoro-3-[(2,3,6-trifluorophenyl)methyl]indazol-1-yl]-5-(3-methylsulfonylphenyl)pyrimidine-4,6-diamine |
| SMILES | CS(=O)(=O)c1cccc(-c2c(N)nc(-n3nc(Cc4c(F)ccc(F)c4F)c4cc(F)ccc43)nc2N)c1 |
| InChI | InChI=1S/C25H18F4N6O2S/c1-38(36,37)14-4-2-3-12(9-14)21-23(30)32-25(33-24(21)31)35-20-8-5-13(26)10-16(20)19(34-35)11-15-17(27)6-7-18(28)22(15)29/h2-10H,11H2,1H3,(H4,30,31,32,33) |
| InChIKey | IJFQJMWVFIYKIN-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 129.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.52 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|