About ethyl (2R)-2-(3,5-difluorophenyl)-2-hydroxy-2-(1H-pyrrol-2-yl)acetate
ethyl (2R)-2-(3,5-difluorophenyl)-2-hydroxy-2-(1H-pyrrol-2-yl)acetate (PubChem CID 53468124) has the molecular formula C14H13F2NO3
and a molecular weight of 281.26 g/mol. Its IUPAC name is ethyl (2R)-2-(3,5-difluorophenyl)-2-hydroxy-2-(1H-pyrrol-2-yl)acetate.
Molecular Properties
| Compound Name | ethyl (2R)-2-(3,5-difluorophenyl)-2-hydroxy-2-(1H-pyrrol-2-yl)acetate |
| PubChem CID | 53468124 |
| Molecular Formula | C14H13F2NO3 |
| Molecular Weight | 281.26 g/mol |
| Exact Mass | 281.09 |
| IUPAC Name | ethyl (2R)-2-(3,5-difluorophenyl)-2-hydroxy-2-(1H-pyrrol-2-yl)acetate |
| SMILES | CCOC(=O)[C@@](O)(c1cc(F)cc(F)c1)c1ccc[nH]1 |
| InChI | InChI=1S/C14H13F2NO3/c1-2-20-13(18)14(19,12-4-3-5-17-12)9-6-10(15)8-11(16)7-9/h3-8,17,19H,2H2,1H3/t14-/m1/s1 |
| InChIKey | LUJWEKOSPXFELI-CQSZACIVSA-N |
| XLogP | 2.09 |
| TPSA | 62.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.26 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl (2R)-2-(3,5-difluorophenyl)-2-hydroxy-2-(1H-pyrrol-2-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (2R)-2-(3,5-difluorophenyl)-2-hydroxy-2-(1H-pyrrol-2-yl)acetate?
The IUPAC name of ethyl (2R)-2-(3,5-difluorophenyl)-2-hydroxy-2-(1H-pyrrol-2-yl)acetate (CID 53468124) is ethyl (2R)-2-(3,5-difluorophenyl)-2-hydroxy-2-(1H-pyrrol-2-yl)acetate.
What is the SMILES notation for ethyl (2R)-2-(3,5-difluorophenyl)-2-hydroxy-2-(1H-pyrrol-2-yl)acetate?
The canonical SMILES for ethyl (2R)-2-(3,5-difluorophenyl)-2-hydroxy-2-(1H-pyrrol-2-yl)acetate is CCOC(=O)[C@@](O)(c1cc(F)cc(F)c1)c1ccc[nH]1.
What is the InChIKey of ethyl (2R)-2-(3,5-difluorophenyl)-2-hydroxy-2-(1H-pyrrol-2-yl)acetate?
The InChIKey is LUJWEKOSPXFELI-CQSZACIVSA-N. The full InChI is InChI=1S/C14H13F2NO3/c1-2-20-13(18)14(19,12-4-3-5-17-12)9-6-10(15)8-11(16)7-9/h3-8,17,19H,2H2,1H3/t14-/m1/s1.
What are the key properties of ethyl (2R)-2-(3,5-difluorophenyl)-2-hydroxy-2-(1H-pyrrol-2-yl)acetate?
ethyl (2R)-2-(3,5-difluorophenyl)-2-hydroxy-2-(1H-pyrrol-2-yl)acetate has a molecular weight of 281.26 g/mol, XLogP of 2.09, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (2R)-2-(3,5-difluorophenyl)-2-hydroxy-2-(1H-pyrrol-2-yl)acetate is sourced from PubChem (CID 53468124), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).