C29H34F3NO3 — CID 53468189
(3R,9S)-7,7-dimethyl-4-(oxan-4-yl)-3-[4-(trifluoromethyl)phenyl]spiro[3,6,8,9-tetrahydrofuro[3,4-c]quinoline-1,1'-cyclopentane]-9-ol (PubChem CID 53468189) has the molecular formula C29H34F3NO3 and a molecular weight of 501.59 g/mol. Its IUPAC name is (3R,9S)-7,7-dimethyl-4-(oxan-4-yl)-3-[4-(trifluoromethyl)phenyl]spiro[3,6,8,9-tetrahydrofuro[3,4-c]quinoline-1,1'-cyclopentane]-9-ol.
| Compound Name | (3R,9S)-7,7-dimethyl-4-(oxan-4-yl)-3-[4-(trifluoromethyl)phenyl]spiro[3,6,8,9-tetrahydrofuro[3,4-c]quinoline-1,1'-cyclopentane]-9-ol |
|---|---|
| PubChem CID | 53468189 |
| Molecular Formula | C29H34F3NO3 |
| Molecular Weight | 501.59 g/mol |
| Exact Mass | 501.25 |
| IUPAC Name | (3R,9S)-7,7-dimethyl-4-(oxan-4-yl)-3-[4-(trifluoromethyl)phenyl]spiro[3,6,8,9-tetrahydrofuro[3,4-c]quinoline-1,1'-cyclopentane]-9-ol |
| SMILES | CC1(C)Cc2nc(C3CCOCC3)c3c(c2[C@@H](O)C1)C1(CCCC1)O[C@@H]3c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C29H34F3NO3/c1-27(2)15-20-22(21(34)16-27)24-23(25(33-20)17-9-13-35-14-10-17)26(36-28(24)11-3-4-12-28)18-5-7-19(8-6-18)29(30,31)32/h5-8,17,21,26,34H,3-4,9-16H2,1-2H3/t21-,26+/m0/s1 |
| InChIKey | OEXZMZYWASFLJV-HFZDXXHNSA-N |
| XLogP | 6.89 |
| TPSA | 51.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.59 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |