C25H29ClN2O7 — CID 53468202
1-[4-[[2-chloro-5-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]phenyl]methyl]phenyl]-3-propan-2-ylimidazolidine-2,4-dione (PubChem CID 53468202) has the molecular formula C25H29ClN2O7 and a molecular weight of 504.97 g/mol. Its IUPAC name is 1-[4-[[2-chloro-5-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]phenyl]methyl]phenyl]-3-propan-2-ylimidazolidine-2,4-dione.
| Compound Name | 1-[4-[[2-chloro-5-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]phenyl]methyl]phenyl]-3-propan-2-ylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 53468202 |
| Molecular Formula | C25H29ClN2O7 |
| Molecular Weight | 504.97 g/mol |
| Exact Mass | 504.17 |
| IUPAC Name | 1-[4-[[2-chloro-5-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]phenyl]methyl]phenyl]-3-propan-2-ylimidazolidine-2,4-dione |
| SMILES | CC(C)N1C(=O)CN(c2ccc(Cc3cc([C@@H]4O[C@H](CO)[C@@H](O)[C@H](O)C4O)ccc3Cl)cc2)C1=O |
| InChI | InChI=1S/C25H29ClN2O7/c1-13(2)28-20(30)11-27(25(28)34)17-6-3-14(4-7-17)9-16-10-15(5-8-18(16)26)24-23(33)22(32)21(31)19(12-29)35-24/h3-8,10,13,19,21-24,29,31-33H,9,11-12H2,1-2H3/t19-,21-,22+,23?,24+/m1/s1 |
| InChIKey | UDKYFCCRHLNGBQ-AGGOYSMVSA-N |
| XLogP | 1.62 |
| TPSA | 130.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.97 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|