C23H25ClN2O7 — CID 53468204
1-[4-[[2-chloro-5-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]phenyl]methyl]phenyl]-3-methylimidazolidine-2,4-dione (PubChem CID 53468204) has the molecular formula C23H25ClN2O7 and a molecular weight of 476.91 g/mol. Its IUPAC name is 1-[4-[[2-chloro-5-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]phenyl]methyl]phenyl]-3-methylimidazolidine-2,4-dione.
| Compound Name | 1-[4-[[2-chloro-5-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]phenyl]methyl]phenyl]-3-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 53468204 |
| Molecular Formula | C23H25ClN2O7 |
| Molecular Weight | 476.91 g/mol |
| Exact Mass | 476.14 |
| IUPAC Name | 1-[4-[[2-chloro-5-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]phenyl]methyl]phenyl]-3-methylimidazolidine-2,4-dione |
| SMILES | CN1C(=O)CN(c2ccc(Cc3cc([C@@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@H]4O)ccc3Cl)cc2)C1=O |
| InChI | InChI=1S/C23H25ClN2O7/c1-25-18(28)10-26(23(25)32)15-5-2-12(3-6-15)8-14-9-13(4-7-16(14)24)22-21(31)20(30)19(29)17(11-27)33-22/h2-7,9,17,19-22,27,29-31H,8,10-11H2,1H3/t17-,19-,20+,21-,22+/m1/s1 |
| InChIKey | ACNGZALWLPISRY-VOFPXKNKSA-N |
| XLogP | 0.84 |
| TPSA | 130.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.91 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|