C20H24O5 — CID 53468286
(1S,2S,5R,8R,9R,12S,15S,17R)-5-ethenyl-2,8-dihydroxy-5,12-dimethyl-10-oxapentacyclo[7.7.1.01,15.02,7.012,17]heptadec-6-ene-3,11-dione (PubChem CID 53468286) has the molecular formula C20H24O5 and a molecular weight of 344.41 g/mol. Its IUPAC name is (1S,2S,5R,8R,9R,12S,15S,17R)-5-ethenyl-2,8-dihydroxy-5,12-dimethyl-10-oxapentacyclo[7.7.1.01,15.02,7.012,17]heptadec-6-ene-3,11-dione.
| Compound Name | (1S,2S,5R,8R,9R,12S,15S,17R)-5-ethenyl-2,8-dihydroxy-5,12-dimethyl-10-oxapentacyclo[7.7.1.01,15.02,7.012,17]heptadec-6-ene-3,11-dione |
|---|---|
| PubChem CID | 53468286 |
| Molecular Formula | C20H24O5 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | (1S,2S,5R,8R,9R,12S,15S,17R)-5-ethenyl-2,8-dihydroxy-5,12-dimethyl-10-oxapentacyclo[7.7.1.01,15.02,7.012,17]heptadec-6-ene-3,11-dione |
| SMILES | C=C[C@]1(C)C=C2[C@@H](O)[C@@H]3OC(=O)[C@@]4(C)CC[C@H]5C[C@]5([C@@H]34)[C@@]2(O)C(=O)C1 |
| InChI | InChI=1S/C20H24O5/c1-4-17(2)8-11-13(22)14-15-18(3,16(23)25-14)6-5-10-7-19(10,15)20(11,24)12(21)9-17/h4,8,10,13-15,22,24H,1,5-7,9H2,2-3H3/t10-,13+,14-,15-,17+,18-,19-,20-/m0/s1 |
| InChIKey | BUKXEXVZJPKXME-KPUXXOKNSA-N |
| XLogP | 1.53 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|