C13H19BrN2O3 — CID 53468363
tert-butyl (2S)-2-[5-(bromomethyl)-1,3-oxazol-2-yl]pyrrolidine-1-carboxylate (PubChem CID 53468363) has the molecular formula C13H19BrN2O3 and a molecular weight of 331.21 g/mol. Its IUPAC name is tert-butyl (2S)-2-[5-(bromomethyl)-1,3-oxazol-2-yl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[5-(bromomethyl)-1,3-oxazol-2-yl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 53468363 |
| Molecular Formula | C13H19BrN2O3 |
| Molecular Weight | 331.21 g/mol |
| Exact Mass | 330.06 |
| IUPAC Name | tert-butyl (2S)-2-[5-(bromomethyl)-1,3-oxazol-2-yl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@H]1c1ncc(CBr)o1 |
| InChI | InChI=1S/C13H19BrN2O3/c1-13(2,3)19-12(17)16-6-4-5-10(16)11-15-8-9(7-14)18-11/h8,10H,4-7H2,1-3H3/t10-/m0/s1 |
| InChIKey | NJTZXQMJKIJDCJ-JTQLQIEISA-N |
| XLogP | 3.64 |
| TPSA | 55.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.21 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|