C12H12N8O3 — CID 5346839
1-[(E)-[4-[(4-methyl-2-oxido-1,2,5-oxadiazol-2-ium-3-yl)methoxy]phenyl]methylideneamino]tetrazol-5-amine (PubChem CID 5346839) has the molecular formula C12H12N8O3 and a molecular weight of 316.28 g/mol. Its IUPAC name is 1-[(E)-[4-[(4-methyl-2-oxido-1,2,5-oxadiazol-2-ium-3-yl)methoxy]phenyl]methylideneamino]tetrazol-5-amine.
| Compound Name | 1-[(E)-[4-[(4-methyl-2-oxido-1,2,5-oxadiazol-2-ium-3-yl)methoxy]phenyl]methylideneamino]tetrazol-5-amine |
|---|---|
| PubChem CID | 5346839 |
| Molecular Formula | C12H12N8O3 |
| Molecular Weight | 316.28 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | 1-[(E)-[4-[(4-methyl-2-oxido-1,2,5-oxadiazol-2-ium-3-yl)methoxy]phenyl]methylideneamino]tetrazol-5-amine |
| SMILES | Cc1no[n+]([O-])c1COc1ccc(/C=N/n2nnnc2N)cc1 |
| InChI | InChI=1S/C12H12N8O3/c1-8-11(20(21)23-16-8)7-22-10-4-2-9(3-5-10)6-14-19-12(13)15-17-18-19/h2-6H,7H2,1H3,(H2,13,15,18)/b14-6+ |
| InChIKey | TYUBJLWGEXUZJJ-MKMNVTDBSA-N |
| XLogP | -0.35 |
| TPSA | 144.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.28 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'} |
|---|