C24H18FNO5 — CID 53468773
[4-benzyl-2-(4-methoxyphenyl)-1,3-oxazol-5-yl] (4-fluorophenyl) carbonate (PubChem CID 53468773) has the molecular formula C24H18FNO5 and a molecular weight of 419.41 g/mol. Its IUPAC name is [4-benzyl-2-(4-methoxyphenyl)-1,3-oxazol-5-yl] (4-fluorophenyl) carbonate.
| Compound Name | [4-benzyl-2-(4-methoxyphenyl)-1,3-oxazol-5-yl] (4-fluorophenyl) carbonate |
|---|---|
| PubChem CID | 53468773 |
| Molecular Formula | C24H18FNO5 |
| Molecular Weight | 419.41 g/mol |
| Exact Mass | 419.12 |
| IUPAC Name | [4-benzyl-2-(4-methoxyphenyl)-1,3-oxazol-5-yl] (4-fluorophenyl) carbonate |
| SMILES | COc1ccc(-c2nc(Cc3ccccc3)c(OC(=O)Oc3ccc(F)cc3)o2)cc1 |
| InChI | InChI=1S/C24H18FNO5/c1-28-19-11-7-17(8-12-19)22-26-21(15-16-5-3-2-4-6-16)23(30-22)31-24(27)29-20-13-9-18(25)10-14-20/h2-14H,15H2,1H3 |
| InChIKey | ZGCCUTJIKGZZAG-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 70.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.41 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|