C12H24N2O3Si — CID 53468918
(2S)-1-[tert-butyl(dimethyl)silyl]-N-methoxy-N-methyl-4-oxoazetidine-2-carboxamide (PubChem CID 53468918) has the molecular formula C12H24N2O3Si and a molecular weight of 272.42 g/mol. Its IUPAC name is (2S)-1-[tert-butyl(dimethyl)silyl]-N-methoxy-N-methyl-4-oxoazetidine-2-carboxamide.
| Compound Name | (2S)-1-[tert-butyl(dimethyl)silyl]-N-methoxy-N-methyl-4-oxoazetidine-2-carboxamide |
|---|---|
| PubChem CID | 53468918 |
| Molecular Formula | C12H24N2O3Si |
| Molecular Weight | 272.42 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | (2S)-1-[tert-butyl(dimethyl)silyl]-N-methoxy-N-methyl-4-oxoazetidine-2-carboxamide |
| SMILES | CON(C)C(=O)[C@@H]1CC(=O)N1[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C12H24N2O3Si/c1-12(2,3)18(6,7)14-9(8-10(14)15)11(16)13(4)17-5/h9H,8H2,1-7H3/t9-/m0/s1 |
| InChIKey | KGMDILOLTHVMIY-VIFPVBQESA-N |
| XLogP | 1.61 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.42 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|