About 2-phenyl-3-(3,4,5-trimethoxyphenyl)sulfanyl-1H-indole
2-phenyl-3-(3,4,5-trimethoxyphenyl)sulfanyl-1H-indole (PubChem CID 53469068) has the molecular formula C23H21NO3S
and a molecular weight of 391.49 g/mol. Its IUPAC name is 2-phenyl-3-(3,4,5-trimethoxyphenyl)sulfanyl-1H-indole.
Molecular Properties
| Compound Name | 2-phenyl-3-(3,4,5-trimethoxyphenyl)sulfanyl-1H-indole |
| PubChem CID | 53469068 |
| Molecular Formula | C23H21NO3S |
| Molecular Weight | 391.49 g/mol |
| Exact Mass | 391.12 |
| IUPAC Name | 2-phenyl-3-(3,4,5-trimethoxyphenyl)sulfanyl-1H-indole |
| SMILES | COc1cc(Sc2c(-c3ccccc3)[nH]c3ccccc23)cc(OC)c1OC |
| InChI | InChI=1S/C23H21NO3S/c1-25-19-13-16(14-20(26-2)22(19)27-3)28-23-17-11-7-8-12-18(17)24-21(23)15-9-5-4-6-10-15/h4-14,24H,1-3H3 |
| InChIKey | HLSLMUOAVIOVIF-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 43.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 391.49 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-phenyl-3-(3,4,5-trimethoxyphenyl)sulfanyl-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenyl-3-(3,4,5-trimethoxyphenyl)sulfanyl-1H-indole?
The IUPAC name of 2-phenyl-3-(3,4,5-trimethoxyphenyl)sulfanyl-1H-indole (CID 53469068) is 2-phenyl-3-(3,4,5-trimethoxyphenyl)sulfanyl-1H-indole.
What is the SMILES notation for 2-phenyl-3-(3,4,5-trimethoxyphenyl)sulfanyl-1H-indole?
The canonical SMILES for 2-phenyl-3-(3,4,5-trimethoxyphenyl)sulfanyl-1H-indole is COc1cc(Sc2c(-c3ccccc3)[nH]c3ccccc23)cc(OC)c1OC.
What is the InChIKey of 2-phenyl-3-(3,4,5-trimethoxyphenyl)sulfanyl-1H-indole?
The InChIKey is HLSLMUOAVIOVIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H21NO3S/c1-25-19-13-16(14-20(26-2)22(19)27-3)28-23-17-11-7-8-12-18(17)24-21(23)15-9-5-4-6-10-15/h4-14,24H,1-3H3.
What are the key properties of 2-phenyl-3-(3,4,5-trimethoxyphenyl)sulfanyl-1H-indole?
2-phenyl-3-(3,4,5-trimethoxyphenyl)sulfanyl-1H-indole has a molecular weight of 391.49 g/mol, XLogP of 6.01, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenyl-3-(3,4,5-trimethoxyphenyl)sulfanyl-1H-indole is sourced from PubChem (CID 53469068), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).