C32H43NO3 — CID 53469392
(3R,9S)-3-(4-tert-butylphenyl)-7,7-dimethyl-4-(oxan-4-yl)spiro[3,6,8,9-tetrahydrofuro[3,4-c]quinoline-1,1'-cyclopentane]-9-ol (PubChem CID 53469392) has the molecular formula C32H43NO3 and a molecular weight of 489.70 g/mol. Its IUPAC name is (3R,9S)-3-(4-tert-butylphenyl)-7,7-dimethyl-4-(oxan-4-yl)spiro[3,6,8,9-tetrahydrofuro[3,4-c]quinoline-1,1'-cyclopentane]-9-ol.
| Compound Name | (3R,9S)-3-(4-tert-butylphenyl)-7,7-dimethyl-4-(oxan-4-yl)spiro[3,6,8,9-tetrahydrofuro[3,4-c]quinoline-1,1'-cyclopentane]-9-ol |
|---|---|
| PubChem CID | 53469392 |
| Molecular Formula | C32H43NO3 |
| Molecular Weight | 489.70 g/mol |
| Exact Mass | 489.32 |
| IUPAC Name | (3R,9S)-3-(4-tert-butylphenyl)-7,7-dimethyl-4-(oxan-4-yl)spiro[3,6,8,9-tetrahydrofuro[3,4-c]quinoline-1,1'-cyclopentane]-9-ol |
| SMILES | CC1(C)Cc2nc(C3CCOCC3)c3c(c2[C@@H](O)C1)C1(CCCC1)O[C@@H]3c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C32H43NO3/c1-30(2,3)22-10-8-21(9-11-22)29-26-27(32(36-29)14-6-7-15-32)25-23(18-31(4,5)19-24(25)34)33-28(26)20-12-16-35-17-13-20/h8-11,20,24,29,34H,6-7,12-19H2,1-5H3/t24-,29+/m0/s1 |
| InChIKey | YNXWDSUPHOXEFN-PWUYWRBVSA-N |
| XLogP | 7.17 |
| TPSA | 51.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.70 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |