About (1S)-N-[(1S)-1,3-diphenylpropoxy]-1-phenylpentan-1-amine
(1S)-N-[(1S)-1,3-diphenylpropoxy]-1-phenylpentan-1-amine (PubChem CID 53469515) has the molecular formula C26H31NO
and a molecular weight of 373.54 g/mol. Its IUPAC name is (1S)-N-[(1S)-1,3-diphenylpropoxy]-1-phenylpentan-1-amine.
Molecular Properties
| Compound Name | (1S)-N-[(1S)-1,3-diphenylpropoxy]-1-phenylpentan-1-amine |
| PubChem CID | 53469515 |
| Molecular Formula | C26H31NO |
| Molecular Weight | 373.54 g/mol |
| Exact Mass | 373.24 |
| IUPAC Name | (1S)-N-[(1S)-1,3-diphenylpropoxy]-1-phenylpentan-1-amine |
| SMILES | CCCC[C@H](NO[C@@H](CCc1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H31NO/c1-2-3-19-25(23-15-9-5-10-16-23)27-28-26(24-17-11-6-12-18-24)21-20-22-13-7-4-8-14-22/h4-18,25-27H,2-3,19-21H2,1H3/t25-,26-/m0/s1 |
| InChIKey | NNXSCMWWVVUWHB-UIOOFZCWSA-N |
| XLogP | 6.81 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 373.54 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (1S)-N-[(1S)-1,3-diphenylpropoxy]-1-phenylpentan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-N-[(1S)-1,3-diphenylpropoxy]-1-phenylpentan-1-amine?
The IUPAC name of (1S)-N-[(1S)-1,3-diphenylpropoxy]-1-phenylpentan-1-amine (CID 53469515) is (1S)-N-[(1S)-1,3-diphenylpropoxy]-1-phenylpentan-1-amine.
What is the SMILES notation for (1S)-N-[(1S)-1,3-diphenylpropoxy]-1-phenylpentan-1-amine?
The canonical SMILES for (1S)-N-[(1S)-1,3-diphenylpropoxy]-1-phenylpentan-1-amine is CCCC[C@H](NO[C@@H](CCc1ccccc1)c1ccccc1)c1ccccc1.
What is the InChIKey of (1S)-N-[(1S)-1,3-diphenylpropoxy]-1-phenylpentan-1-amine?
The InChIKey is NNXSCMWWVVUWHB-UIOOFZCWSA-N. The full InChI is InChI=1S/C26H31NO/c1-2-3-19-25(23-15-9-5-10-16-23)27-28-26(24-17-11-6-12-18-24)21-20-22-13-7-4-8-14-22/h4-18,25-27H,2-3,19-21H2,1H3/t25-,26-/m0/s1.
What are the key properties of (1S)-N-[(1S)-1,3-diphenylpropoxy]-1-phenylpentan-1-amine?
(1S)-N-[(1S)-1,3-diphenylpropoxy]-1-phenylpentan-1-amine has a molecular weight of 373.54 g/mol, XLogP of 6.81, 11 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-N-[(1S)-1,3-diphenylpropoxy]-1-phenylpentan-1-amine is sourced from PubChem (CID 53469515), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).